About 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline
3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline (PubChem CID 172818080) has the molecular formula C18H29BrFNOSi
and a molecular weight of 402.42 g/mol. Its IUPAC name is 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline.
Molecular Properties
| Compound Name | 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline |
| PubChem CID | 172818080 |
| Molecular Formula | C18H29BrFNOSi |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C18H29BrFNOSi/c1-18(2,3)23(4,5)22-17-9-7-6-8-16(17)21-13-10-11-15(20)14(19)12-13/h10-12,16-17,21H,6-9H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | TVNFLVVWQYVDPT-IAGOWNOFSA-N |
| XLogP | 6.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline?
The IUPAC name of 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline (CID 172818080) is 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline.
What is the SMILES notation for 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline?
The canonical SMILES for 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline is CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1Nc1ccc(F)c(Br)c1.
What is the InChIKey of 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline?
The InChIKey is TVNFLVVWQYVDPT-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H29BrFNOSi/c1-18(2,3)23(4,5)22-17-9-7-6-8-16(17)21-13-10-11-15(20)14(19)12-13/h10-12,16-17,21H,6-9H2,1-5H3/t16-,17-/m1/s1.
What are the key properties of 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline?
3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline has a molecular weight of 402.42 g/mol, XLogP of 6.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-fluoroaniline is sourced from PubChem (CID 172818080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).