About N,N'-diethylpropanimidamide;hydrochloride
N,N'-diethylpropanimidamide;hydrochloride (PubChem CID 172818517) has the molecular formula C7H17ClN2
and a molecular weight of 164.68 g/mol. Its IUPAC name is N,N'-diethylpropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N,N'-diethylpropanimidamide;hydrochloride |
| PubChem CID | 172818517 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N,N'-diethylpropanimidamide;hydrochloride |
| SMILES | CC/N=C(\CC)NCC.Cl |
| InChI | InChI=1S/C7H16N2.ClH/c1-4-7(8-5-2)9-6-3;/h4-6H2,1-3H3,(H,8,9);1H |
| InChIKey | TXARDISIOAYHRT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diethylpropanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diethylpropanimidamide;hydrochloride?
The IUPAC name of N,N'-diethylpropanimidamide;hydrochloride (CID 172818517) is N,N'-diethylpropanimidamide;hydrochloride.
What is the SMILES notation for N,N'-diethylpropanimidamide;hydrochloride?
The canonical SMILES for N,N'-diethylpropanimidamide;hydrochloride is CC/N=C(\CC)NCC.Cl.
What is the InChIKey of N,N'-diethylpropanimidamide;hydrochloride?
The InChIKey is TXARDISIOAYHRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.ClH/c1-4-7(8-5-2)9-6-3;/h4-6H2,1-3H3,(H,8,9);1H.
What are the key properties of N,N'-diethylpropanimidamide;hydrochloride?
N,N'-diethylpropanimidamide;hydrochloride has a molecular weight of 164.68 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diethylpropanimidamide;hydrochloride is sourced from PubChem (CID 172818517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).