azane;hydroperoxyboronic acid

H12BN3O4 — CID 172819461

IUPACazane;hydroperoxyboronic acid
SMILESN.N.N.OOB(O)O
InChIInChI=1S/BH3O4.3H3N/c2-1(3)5-4;;;/h2-4H;3*1H3
InChIKeyUAILCXANVPDDLP-UHFFFAOYSA-N
MW128.93 g/mol
LogP-1.07
Rot. Bonds1

About azane;hydroperoxyboronic acid

azane;hydroperoxyboronic acid (PubChem CID 172819461) has the molecular formula H12BN3O4 and a molecular weight of 128.93 g/mol. Its IUPAC name is azane;hydroperoxyboronic acid.

Molecular Properties

Compound Nameazane;hydroperoxyboronic acid
PubChem CID172819461
Molecular FormulaH12BN3O4
Molecular Weight128.93 g/mol
Exact Mass129.09
IUPAC Nameazane;hydroperoxyboronic acid
SMILESN.N.N.OOB(O)O
InChIInChI=1S/BH3O4.3H3N/c2-1(3)5-4;;;/h2-4H;3*1H3
InChIKeyUAILCXANVPDDLP-UHFFFAOYSA-N
XLogP-1.07
TPSA174.92 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500128.93
LogP ≤ 5-1.07
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze azane;hydroperoxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;hydroperoxyboronic acid?
The IUPAC name of azane;hydroperoxyboronic acid (CID 172819461) is azane;hydroperoxyboronic acid.
What is the SMILES notation for azane;hydroperoxyboronic acid?
The canonical SMILES for azane;hydroperoxyboronic acid is N.N.N.OOB(O)O.
What is the InChIKey of azane;hydroperoxyboronic acid?
The InChIKey is UAILCXANVPDDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O4.3H3N/c2-1(3)5-4;;;/h2-4H;3*1H3.
What are the key properties of azane;hydroperoxyboronic acid?
azane;hydroperoxyboronic acid has a molecular weight of 128.93 g/mol, XLogP of -1.07, 1 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroperoxyboronic acid is sourced from PubChem (CID 172819461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).