About N',N'-dimethylethane-1,2-diamine;trihydrochloride
N',N'-dimethylethane-1,2-diamine;trihydrochloride (PubChem CID 172819599) has the molecular formula C4H15Cl3N2
and a molecular weight of 197.54 g/mol. Its IUPAC name is N',N'-dimethylethane-1,2-diamine;trihydrochloride.
Molecular Properties
| Compound Name | N',N'-dimethylethane-1,2-diamine;trihydrochloride |
| PubChem CID | 172819599 |
| Molecular Formula | C4H15Cl3N2 |
| Molecular Weight | 197.54 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | N',N'-dimethylethane-1,2-diamine;trihydrochloride |
| SMILES | CN(C)CCN.Cl.Cl.Cl |
| InChI | InChI=1S/C4H12N2.3ClH/c1-6(2)4-3-5;;;/h3-5H2,1-2H3;3*1H |
| InChIKey | UATZQJFMVKAYGG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N',N'-dimethylethane-1,2-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethylethane-1,2-diamine;trihydrochloride?
The IUPAC name of N',N'-dimethylethane-1,2-diamine;trihydrochloride (CID 172819599) is N',N'-dimethylethane-1,2-diamine;trihydrochloride.
What is the SMILES notation for N',N'-dimethylethane-1,2-diamine;trihydrochloride?
The canonical SMILES for N',N'-dimethylethane-1,2-diamine;trihydrochloride is CN(C)CCN.Cl.Cl.Cl.
What is the InChIKey of N',N'-dimethylethane-1,2-diamine;trihydrochloride?
The InChIKey is UATZQJFMVKAYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.3ClH/c1-6(2)4-3-5;;;/h3-5H2,1-2H3;3*1H.
What are the key properties of N',N'-dimethylethane-1,2-diamine;trihydrochloride?
N',N'-dimethylethane-1,2-diamine;trihydrochloride has a molecular weight of 197.54 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethylethane-1,2-diamine;trihydrochloride is sourced from PubChem (CID 172819599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).