About 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide
1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide (PubChem CID 172820210) has the molecular formula C6H14I2N2
and a molecular weight of 368.00 g/mol. Its IUPAC name is 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide.
Molecular Properties
| Compound Name | 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide |
| PubChem CID | 172820210 |
| Molecular Formula | C6H14I2N2 |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide |
| SMILES | CC1=NCCCN1C.I.I |
| InChI | InChI=1S/C6H12N2.2HI/c1-6-7-4-3-5-8(6)2;;/h3-5H2,1-2H3;2*1H |
| InChIKey | UCWJAQAKHZMGRT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide?
The IUPAC name of 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide (CID 172820210) is 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide.
What is the SMILES notation for 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide?
The canonical SMILES for 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide is CC1=NCCCN1C.I.I.
What is the InChIKey of 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide?
The InChIKey is UCWJAQAKHZMGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2HI/c1-6-7-4-3-5-8(6)2;;/h3-5H2,1-2H3;2*1H.
What are the key properties of 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide?
1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide has a molecular weight of 368.00 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5,6-dihydro-4H-pyrimidine;dihydroiodide is sourced from PubChem (CID 172820210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).