C11H11ClF3N3 — CID 172820478
5-(chloromethyl)-6-propyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 172820478) has the molecular formula C11H11ClF3N3 and a molecular weight of 277.68 g/mol. Its IUPAC name is 5-(chloromethyl)-6-propyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(chloromethyl)-6-propyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 172820478 |
| Molecular Formula | C11H11ClF3N3 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-(chloromethyl)-6-propyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCCc1ccc2nc(C(F)(F)F)nn2c1CCl |
| InChI | InChI=1S/C11H11ClF3N3/c1-2-3-7-4-5-9-16-10(11(13,14)15)17-18(9)8(7)6-12/h4-5H,2-3,6H2,1H3 |
| InChIKey | UDSXYWJFIFWWHO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|