nitrous acid azide

HN4O2- — CID 172820996

IUPACnitrous acid azide
SMILESO=NO.[N-]=[N+]=[N-]
InChIInChI=1S/N3.HNO2/c1-3-2;2-1-3/h;(H,2,3)/q-1;
InChIKeyUFJPAYNKJQERJF-UHFFFAOYSA-N
MW89.03 g/mol
LogP1.01
Rot. Bonds

About nitrous acid azide

nitrous acid azide (PubChem CID 172820996) has the molecular formula HN4O2- and a molecular weight of 89.03 g/mol. Its IUPAC name is nitrous acid azide.

Molecular Properties

Compound Namenitrous acid azide
PubChem CID172820996
Molecular FormulaHN4O2-
Molecular Weight89.03 g/mol
Exact Mass89.01
IUPAC Namenitrous acid azide
SMILESO=NO.[N-]=[N+]=[N-]
InChIInChI=1S/N3.HNO2/c1-3-2;2-1-3/h;(H,2,3)/q-1;
InChIKeyUFJPAYNKJQERJF-UHFFFAOYSA-N
XLogP1.01
TPSA108.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50089.03
LogP ≤ 51.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze nitrous acid azide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of nitrous acid azide?
The IUPAC name of nitrous acid azide (CID 172820996) is nitrous acid azide.
What is the SMILES notation for nitrous acid azide?
The canonical SMILES for nitrous acid azide is O=NO.[N-]=[N+]=[N-].
What is the InChIKey of nitrous acid azide?
The InChIKey is UFJPAYNKJQERJF-UHFFFAOYSA-N. The full InChI is InChI=1S/N3.HNO2/c1-3-2;2-1-3/h;(H,2,3)/q-1;.
What are the key properties of nitrous acid azide?
nitrous acid azide has a molecular weight of 89.03 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitrous acid azide is sourced from PubChem (CID 172820996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).