C18H24BrO2S+ — CID 172821042
4-[1-(2-bromophenyl)-2-(5-methyl-2,3-dihydrothiophen-1-ium-1-yl)ethoxy]oxane (PubChem CID 172821042) has the molecular formula C18H24BrO2S+ and a molecular weight of 384.36 g/mol. Its IUPAC name is 4-[1-(2-bromophenyl)-2-(5-methyl-2,3-dihydrothiophen-1-ium-1-yl)ethoxy]oxane.
| Compound Name | 4-[1-(2-bromophenyl)-2-(5-methyl-2,3-dihydrothiophen-1-ium-1-yl)ethoxy]oxane |
|---|---|
| PubChem CID | 172821042 |
| Molecular Formula | C18H24BrO2S+ |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 4-[1-(2-bromophenyl)-2-(5-methyl-2,3-dihydrothiophen-1-ium-1-yl)ethoxy]oxane |
| SMILES | CC1=CCC[S+]1CC(OC1CCOCC1)c1ccccc1Br |
| InChI | InChI=1S/C18H24BrO2S/c1-14-5-4-12-22(14)13-18(16-6-2-3-7-17(16)19)21-15-8-10-20-11-9-15/h2-3,5-7,15,18H,4,8-13H2,1H3/q+1 |
| InChIKey | UFNRAIQQFPQUBY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|