About N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate
N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate (PubChem CID 172821400) has the molecular formula C6H16N2O2
and a molecular weight of 148.21 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate.
Molecular Properties
| Compound Name | N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate |
| PubChem CID | 172821400 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate |
| SMILES | CC(C)/C(N)=N/CCO.O |
| InChI | InChI=1S/C6H14N2O.H2O/c1-5(2)6(7)8-3-4-9;/h5,9H,3-4H2,1-2H3,(H2,7,8);1H2 |
| InChIKey | UGVSZASAQKTWDI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate?
The IUPAC name of N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate (CID 172821400) is N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate.
What is the SMILES notation for N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate?
The canonical SMILES for N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate is CC(C)/C(N)=N/CCO.O.
What is the InChIKey of N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate?
The InChIKey is UGVSZASAQKTWDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.H2O/c1-5(2)6(7)8-3-4-9;/h5,9H,3-4H2,1-2H3,(H2,7,8);1H2.
What are the key properties of N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate?
N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate has a molecular weight of 148.21 g/mol, XLogP of -0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-hydroxyethyl)-2-methylpropanimidamide;hydrate is sourced from PubChem (CID 172821400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).