C23H38ClN5O4Si — CID 172821767
1-[[(3aR,4R,6R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-N-propylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 172821767) has the molecular formula C23H38ClN5O4Si and a molecular weight of 512.13 g/mol. Its IUPAC name is 1-[[(3aR,4R,6R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-N-propylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[[(3aR,4R,6R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-N-propylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172821767 |
| Molecular Formula | C23H38ClN5O4Si |
| Molecular Weight | 512.13 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[[(3aR,4R,6R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-N-propylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCNc1nc(Cl)nc2c1cnn2C[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C23H38ClN5O4Si/c1-9-10-25-19-14-11-26-29(20(14)28-21(24)27-19)12-15-17-18(33-23(5,6)32-17)16(31-15)13-30-34(7,8)22(2,3)4/h11,15-18H,9-10,12-13H2,1-8H3,(H,25,27,28)/t15-,16-,17+,18-/m1/s1 |
| InChIKey | UIAJVUGXZSWBIJ-ZJPYXAASSA-N |
| XLogP | 4.61 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.13 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|