About chloroethene;1,1-dichloroethene;hydrochloride
chloroethene;1,1-dichloroethene;hydrochloride (PubChem CID 172822334) has the molecular formula C6H9Cl5
and a molecular weight of 258.40 g/mol. Its IUPAC name is chloroethene;1,1-dichloroethene;hydrochloride.
Molecular Properties
| Compound Name | chloroethene;1,1-dichloroethene;hydrochloride |
| PubChem CID | 172822334 |
| Molecular Formula | C6H9Cl5 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | chloroethene;1,1-dichloroethene;hydrochloride |
| SMILES | C=C(Cl)Cl.C=CCl.C=CCl.Cl |
| InChI | InChI=1S/C2H2Cl2.2C2H3Cl.ClH/c1-2(3)4;2*1-2-3;/h1H2;2*2H,1H2;1H |
| InChIKey | UJWJBDDYXOUCBL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chloroethene;1,1-dichloroethene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethene;1,1-dichloroethene;hydrochloride?
The IUPAC name of chloroethene;1,1-dichloroethene;hydrochloride (CID 172822334) is chloroethene;1,1-dichloroethene;hydrochloride.
What is the SMILES notation for chloroethene;1,1-dichloroethene;hydrochloride?
The canonical SMILES for chloroethene;1,1-dichloroethene;hydrochloride is C=C(Cl)Cl.C=CCl.C=CCl.Cl.
What is the InChIKey of chloroethene;1,1-dichloroethene;hydrochloride?
The InChIKey is UJWJBDDYXOUCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl2.2C2H3Cl.ClH/c1-2(3)4;2*1-2-3;/h1H2;2*2H,1H2;1H.
What are the key properties of chloroethene;1,1-dichloroethene;hydrochloride?
chloroethene;1,1-dichloroethene;hydrochloride has a molecular weight of 258.40 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethene;1,1-dichloroethene;hydrochloride is sourced from PubChem (CID 172822334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).