C28H19ClF7NO3 — CID 172823721
1-[2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]phenyl]-2-hydroxy-2-phenylethanone (PubChem CID 172823721) has the molecular formula C28H19ClF7NO3 and a molecular weight of 585.90 g/mol. Its IUPAC name is 1-[2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]phenyl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]phenyl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 172823721 |
| Molecular Formula | C28H19ClF7NO3 |
| Molecular Weight | 585.90 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | 1-[2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]phenyl]-2-hydroxy-2-phenylethanone |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-c1cc(-c2ccc(Cl)c(C(=O)C(O)c3ccccc3)c2)on1 |
| InChI | InChI=1S/C28H19ClF7NO3/c1-14-10-18(26(30,27(31,32)33)28(34,35)36)11-15(2)23(14)21-13-22(40-37-21)17-8-9-20(29)19(12-17)25(39)24(38)16-6-4-3-5-7-16/h3-13,24,38H,1-2H3 |
| InChIKey | UONPGVGXKGNSEP-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.90 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |