About (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate
(4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate (PubChem CID 172824274) has the molecular formula C10H13F3O3
and a molecular weight of 238.20 g/mol. Its IUPAC name is (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate |
| PubChem CID | 172824274 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate |
| SMILES | C=C(C)C(=O)CCOC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H13F3O3/c1-7(2)8(14)4-6-16-9(15)3-5-10(11,12)13/h1,3-6H2,2H3 |
| InChIKey | UQMMEJWWODGPLB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate?
The IUPAC name of (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate (CID 172824274) is (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate.
What is the SMILES notation for (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate?
The canonical SMILES for (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate is C=C(C)C(=O)CCOC(=O)CCC(F)(F)F.
What is the InChIKey of (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate?
The InChIKey is UQMMEJWWODGPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O3/c1-7(2)8(14)4-6-16-9(15)3-5-10(11,12)13/h1,3-6H2,2H3.
What are the key properties of (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate?
(4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate has a molecular weight of 238.20 g/mol, XLogP of 2.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-3-oxopent-4-enyl) 4,4,4-trifluorobutanoate is sourced from PubChem (CID 172824274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).