About 7H-purin-8-yl piperazine-1-carboxylate
7H-purin-8-yl piperazine-1-carboxylate (PubChem CID 172824654) has the molecular formula C10H12N6O2
and a molecular weight of 248.25 g/mol. Its IUPAC name is 7H-purin-8-yl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 7H-purin-8-yl piperazine-1-carboxylate |
| PubChem CID | 172824654 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 7H-purin-8-yl piperazine-1-carboxylate |
| SMILES | O=C(Oc1nc2ncncc2[nH]1)N1CCNCC1 |
| InChI | InChI=1S/C10H12N6O2/c17-10(16-3-1-11-2-4-16)18-9-14-7-5-12-6-13-8(7)15-9/h5-6,11H,1-4H2,(H,12,13,14,15) |
| InChIKey | URSOJSRANNLHRT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7H-purin-8-yl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-8-yl piperazine-1-carboxylate?
The IUPAC name of 7H-purin-8-yl piperazine-1-carboxylate (CID 172824654) is 7H-purin-8-yl piperazine-1-carboxylate.
What is the SMILES notation for 7H-purin-8-yl piperazine-1-carboxylate?
The canonical SMILES for 7H-purin-8-yl piperazine-1-carboxylate is O=C(Oc1nc2ncncc2[nH]1)N1CCNCC1.
What is the InChIKey of 7H-purin-8-yl piperazine-1-carboxylate?
The InChIKey is URSOJSRANNLHRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6O2/c17-10(16-3-1-11-2-4-16)18-9-14-7-5-12-6-13-8(7)15-9/h5-6,11H,1-4H2,(H,12,13,14,15).
What are the key properties of 7H-purin-8-yl piperazine-1-carboxylate?
7H-purin-8-yl piperazine-1-carboxylate has a molecular weight of 248.25 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-8-yl piperazine-1-carboxylate is sourced from PubChem (CID 172824654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).