About (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium
(3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172824929) has the molecular formula C15H25O3S2+
and a molecular weight of 317.50 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
Molecular Properties
| Compound Name | (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| PubChem CID | 172824929 |
| Molecular Formula | C15H25O3S2+ |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | CC(C)(C)c1cc(C[S+]=S(=O)(O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O3S2/c1-14(2,3)12-7-11(10-19-20(16,17)18)8-13(9-12)15(4,5)6/h7-9H,10H2,1-6H3,(H-,16,17,18)/p+1 |
| InChIKey | USPOWEQIDCEHLM-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium?
The IUPAC name of (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium (CID 172824929) is (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium.
What is the SMILES notation for (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium?
The canonical SMILES for (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium is CC(C)(C)c1cc(C[S+]=S(=O)(O)O)cc(C(C)(C)C)c1.
What is the InChIKey of (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium?
The InChIKey is USPOWEQIDCEHLM-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H24O3S2/c1-14(2,3)12-7-11(10-19-20(16,17)18)8-13(9-12)15(4,5)6/h7-9H,10H2,1-6H3,(H-,16,17,18)/p+1.
What are the key properties of (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium?
(3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium has a molecular weight of 317.50 g/mol, XLogP of 4.01, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butylphenyl)methyl-[dihydroxy(oxo)-λ6-sulfanylidene]sulfanium is sourced from PubChem (CID 172824929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).