About 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea
1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea (PubChem CID 17282501) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea |
| PubChem CID | 17282501 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea |
| SMILES | CC(=O)c1cccc(NC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H14N2O4/c1-10(19)11-3-2-4-12(7-11)17-16(20)18-13-5-6-14-15(8-13)22-9-21-14/h2-8H,9H2,1H3,(H2,17,18,20) |
| InChIKey | MPICIIISIYFFFC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea?
The IUPAC name of 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea (CID 17282501) is 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea.
What is the SMILES notation for 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea?
The canonical SMILES for 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea is CC(=O)c1cccc(NC(=O)Nc2ccc3c(c2)OCO3)c1.
What is the InChIKey of 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea?
The InChIKey is MPICIIISIYFFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-10(19)11-3-2-4-12(7-11)17-16(20)18-13-5-6-14-15(8-13)22-9-21-14/h2-8H,9H2,1H3,(H2,17,18,20).
What are the key properties of 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea?
1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea has a molecular weight of 298.30 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-yl)urea is sourced from PubChem (CID 17282501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).