C17H18N2O3 — CID 17282505
1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethylphenyl)urea (PubChem CID 17282505) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 17282505 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)Nc2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-10-6-11(2)16(12(3)7-10)19-17(20)18-13-4-5-14-15(8-13)22-9-21-14/h4-8H,9H2,1-3H3,(H2,18,19,20) |
| InChIKey | IMJVZFQSPXGMTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |