C18H24N4O — CID 172825173
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide (PubChem CID 172825173) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 172825173 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
| SMILES | CN1C(C)(C)CC(NC(=O)C2=NN=C3C2=CC2=C3C2)CC1(C)C |
| InChI | InChI=1S/C18H24N4O/c1-17(2)8-11(9-18(3,4)22(17)5)19-16(23)15-13-7-10-6-12(10)14(13)20-21-15/h7,11H,6,8-9H2,1-5H3,(H,19,23) |
| InChIKey | UTMJVLPXIOVLCZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |