C38H41OP — CID 172825186
1,1'-biphenyl;4-bis(2,3,5,6-tetramethylphenyl)phosphanylphenol (PubChem CID 172825186) has the molecular formula C38H41OP and a molecular weight of 544.72 g/mol. Its IUPAC name is 1,1'-biphenyl;4-bis(2,3,5,6-tetramethylphenyl)phosphanylphenol.
| Compound Name | 1,1'-biphenyl;4-bis(2,3,5,6-tetramethylphenyl)phosphanylphenol |
|---|---|
| PubChem CID | 172825186 |
| Molecular Formula | C38H41OP |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 1,1'-biphenyl;4-bis(2,3,5,6-tetramethylphenyl)phosphanylphenol |
| SMILES | Cc1cc(C)c(C)c(P(c2ccc(O)cc2)c2c(C)c(C)cc(C)c2C)c1C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31OP.C12H10/c1-15-13-16(2)20(6)25(19(15)5)28(24-11-9-23(27)10-12-24)26-21(7)17(3)14-18(4)22(26)8;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h9-14,27H,1-8H3;1-10H |
| InChIKey | UTNCXZRMWUZPNI-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|