About 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol
2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol (PubChem CID 172825443) has the molecular formula C28H34O2S
and a molecular weight of 434.65 g/mol. Its IUPAC name is 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol.
Molecular Properties
| Compound Name | 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol |
| PubChem CID | 172825443 |
| Molecular Formula | C28H34O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol |
| SMILES | Oc1c(C2CCC2)cc(Sc2cc(C3CCC3)c(O)c(C3CCC3)c2)cc1C1CCC1 |
| InChI | InChI=1S/C28H34O2S/c29-27-23(17-5-1-6-17)13-21(14-24(27)18-7-2-8-18)31-22-15-25(19-9-3-10-19)28(30)26(16-22)20-11-4-12-20/h13-20,29-30H,1-12H2 |
| InChIKey | UUJFIWKJEQIHEH-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol?
The IUPAC name of 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol (CID 172825443) is 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol.
What is the SMILES notation for 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol?
The canonical SMILES for 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol is Oc1c(C2CCC2)cc(Sc2cc(C3CCC3)c(O)c(C3CCC3)c2)cc1C1CCC1.
What is the InChIKey of 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol?
The InChIKey is UUJFIWKJEQIHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34O2S/c29-27-23(17-5-1-6-17)13-21(14-24(27)18-7-2-8-18)31-22-15-25(19-9-3-10-19)28(30)26(16-22)20-11-4-12-20/h13-20,29-30H,1-12H2.
What are the key properties of 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol?
2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol has a molecular weight of 434.65 g/mol, XLogP of 8.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(cyclobutyl)-4-[3,5-di(cyclobutyl)-4-hydroxyphenyl]sulfanylphenol is sourced from PubChem (CID 172825443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).