C4I8 — CID 172825779
1,1,1,2,3,4,4,4-octaiodobut-2-ene (PubChem CID 172825779) has the molecular formula C4I8 and a molecular weight of 1063.28 g/mol. Its IUPAC name is 1,1,1,2,3,4,4,4-octaiodobut-2-ene.
| Compound Name | 1,1,1,2,3,4,4,4-octaiodobut-2-ene |
|---|---|
| PubChem CID | 172825779 |
| Molecular Formula | C4I8 |
| Molecular Weight | 1063.28 g/mol |
| Exact Mass | 1063.24 |
| IUPAC Name | 1,1,1,2,3,4,4,4-octaiodobut-2-ene |
| SMILES | IC(=C(I)C(I)(I)I)C(I)(I)I |
| InChI | InChI=1S/C4I8/c5-1(3(7,8)9)2(6)4(10,11)12 |
| InChIKey | UVNBMCVHDWDBJH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.28 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|