C8H11F3N4O4S — CID 172826444
(2S,5R)-6-hydroxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 172826444) has the molecular formula C8H11F3N4O4S and a molecular weight of 316.26 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 172826444 |
| Molecular Formula | C8H11F3N4O4S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N'-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | NC(=NS(=O)(=O)C(F)(F)F)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C8H11F3N4O4S/c9-8(10,11)20(18,19)13-6(12)5-2-1-4-3-14(5)7(16)15(4)17/h4-5,17H,1-3H2,(H2,12,13)/t4-,5+/m1/s1 |
| InChIKey | UXTLIRJHYCQAKH-UHNVWZDZSA-N |
| XLogP | -0.15 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|