About CID 172826521
CID 172826521 (PubChem CID 172826521) has the molecular formula C16H29N3NaO3
and a molecular weight of 334.42 g/mol.
Molecular Properties
| Compound Name | CID 172826521 |
| PubChem CID | 172826521 |
| Molecular Formula | C16H29N3NaO3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | — |
| SMILES | C[C@H]1CCCC(C)(C)[C@@H]1COC(=O)N1CCN(C(N)=O)CC1.[Na] |
| InChI | InChI=1S/C16H29N3O3.Na/c1-12-5-4-6-16(2,3)13(12)11-22-15(21)19-9-7-18(8-10-19)14(17)20;/h12-13H,4-11H2,1-3H3,(H2,17,20);/t12-,13+;/m0./s1 |
| InChIKey | UXZRCFPPTFNDAJ-JHEYCYPBSA-N |
| XLogP | 1.90 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172826521 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172826521?
The IUPAC name of CID 172826521 (CID 172826521) is not available.
What is the SMILES notation for CID 172826521?
The canonical SMILES for CID 172826521 is C[C@H]1CCCC(C)(C)[C@@H]1COC(=O)N1CCN(C(N)=O)CC1.[Na].
What is the InChIKey of CID 172826521?
The InChIKey is UXZRCFPPTFNDAJ-JHEYCYPBSA-N. The full InChI is InChI=1S/C16H29N3O3.Na/c1-12-5-4-6-16(2,3)13(12)11-22-15(21)19-9-7-18(8-10-19)14(17)20;/h12-13H,4-11H2,1-3H3,(H2,17,20);/t12-,13+;/m0./s1.
What are the key properties of CID 172826521?
CID 172826521 has a molecular weight of 334.42 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172826521 is sourced from PubChem (CID 172826521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).