C6H11FO7S — CID 172826559
[(3R,4S,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate (PubChem CID 172826559) has the molecular formula C6H11FO7S and a molecular weight of 246.21 g/mol. Its IUPAC name is [(3R,4S,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate.
| Compound Name | [(3R,4S,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 172826559 |
| Molecular Formula | C6H11FO7S |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | [(3R,4S,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1(F)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11FO7S/c1-15(11,12)14-6(7)5(10)4(9)3(2-8)13-6/h3-5,8-10H,2H2,1H3/t3-,4-,5-,6?/m1/s1 |
| InChIKey | UYCSFJQXZQXCPH-JDJSBBGDSA-N |
| XLogP | -2.30 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|