About 4aH-quinazoline-2,4-dione
4aH-quinazoline-2,4-dione (PubChem CID 172828202) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 4aH-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 4aH-quinazoline-2,4-dione |
| PubChem CID | 172828202 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4aH-quinazoline-2,4-dione |
| SMILES | O=C1N=C2C=CC=CC2C(=O)N1 |
| InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-5H,(H,10,11,12) |
| InChIKey | MYFMEFVNOOBEQJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4aH-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-quinazoline-2,4-dione?
The IUPAC name of 4aH-quinazoline-2,4-dione (CID 172828202) is 4aH-quinazoline-2,4-dione.
What is the SMILES notation for 4aH-quinazoline-2,4-dione?
The canonical SMILES for 4aH-quinazoline-2,4-dione is O=C1N=C2C=CC=CC2C(=O)N1.
What is the InChIKey of 4aH-quinazoline-2,4-dione?
The InChIKey is MYFMEFVNOOBEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-5H,(H,10,11,12).
What are the key properties of 4aH-quinazoline-2,4-dione?
4aH-quinazoline-2,4-dione has a molecular weight of 162.15 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-quinazoline-2,4-dione is sourced from PubChem (CID 172828202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).