About chloro(diphenyl)stibane;hydrate
chloro(diphenyl)stibane;hydrate (PubChem CID 172829662) has the molecular formula C12H12ClOSb
and a molecular weight of 329.44 g/mol. Its IUPAC name is chloro(diphenyl)stibane;hydrate.
Molecular Properties
| Compound Name | chloro(diphenyl)stibane;hydrate |
| PubChem CID | 172829662 |
| Molecular Formula | C12H12ClOSb |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | chloro(diphenyl)stibane;hydrate |
| SMILES | Cl[Sb](c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/2C6H5.ClH.H2O.Sb/c2*1-2-4-6-5-3-1;;;/h2*1-5H;1H;1H2;/q;;;;+1/p-1 |
| InChIKey | DBIDPPCGUKNBPE-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloro(diphenyl)stibane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(diphenyl)stibane;hydrate?
The IUPAC name of chloro(diphenyl)stibane;hydrate (CID 172829662) is chloro(diphenyl)stibane;hydrate.
What is the SMILES notation for chloro(diphenyl)stibane;hydrate?
The canonical SMILES for chloro(diphenyl)stibane;hydrate is Cl[Sb](c1ccccc1)c1ccccc1.O.
What is the InChIKey of chloro(diphenyl)stibane;hydrate?
The InChIKey is DBIDPPCGUKNBPE-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H5.ClH.H2O.Sb/c2*1-2-4-6-5-3-1;;;/h2*1-5H;1H;1H2;/q;;;;+1/p-1.
What are the key properties of chloro(diphenyl)stibane;hydrate?
chloro(diphenyl)stibane;hydrate has a molecular weight of 329.44 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(diphenyl)stibane;hydrate is sourced from PubChem (CID 172829662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).