About 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron
2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron (PubChem CID 172831383) has the molecular formula C12H17FeOS+
and a molecular weight of 265.18 g/mol. Its IUPAC name is 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron |
| PubChem CID | 172831383 |
| Molecular Formula | C12H17FeOS+ |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron |
| SMILES | Cc1cc([S+]2CCCC2)cc(C)c1O.[Fe] |
| InChI | InChI=1S/C12H16OS.Fe/c1-9-7-11(8-10(2)12(9)13)14-5-3-4-6-14;/h7-8H,3-6H2,1-2H3;/p+1 |
| InChIKey | VOEMBBWBVGNVHZ-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron?
The IUPAC name of 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron (CID 172831383) is 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron.
What is the SMILES notation for 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron?
The canonical SMILES for 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron is Cc1cc([S+]2CCCC2)cc(C)c1O.[Fe].
What is the InChIKey of 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron?
The InChIKey is VOEMBBWBVGNVHZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H16OS.Fe/c1-9-7-11(8-10(2)12(9)13)14-5-3-4-6-14;/h7-8H,3-6H2,1-2H3;/p+1.
What are the key properties of 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron?
2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron has a molecular weight of 265.18 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-(thiolan-1-ium-1-yl)phenol;iron is sourced from PubChem (CID 172831383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).