C26H37N7O5S2 — CID 172831440
2-[4-[2-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxy-1,3-thiazole-5-carboxamide;hydroxylamine (PubChem CID 172831440) has the molecular formula C26H37N7O5S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is 2-[4-[2-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxy-1,3-thiazole-5-carboxamide;hydroxylamine.
| Compound Name | 2-[4-[2-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxy-1,3-thiazole-5-carboxamide;hydroxylamine |
|---|---|
| PubChem CID | 172831440 |
| Molecular Formula | C26H37N7O5S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 2-[4-[2-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-N-hydroxy-1,3-thiazole-5-carboxamide;hydroxylamine |
| SMILES | CN(C)CCN(C)Cc1cccc(-c2ccccc2S(=O)(=O)N2CCN(c3ncc(C(=O)NO)s3)CC2)c1.NO |
| InChI | InChI=1S/C26H34N6O4S2.H3NO/c1-29(2)11-12-30(3)19-20-7-6-8-21(17-20)22-9-4-5-10-24(22)38(35,36)32-15-13-31(14-16-32)26-27-18-23(37-26)25(33)28-34;1-2/h4-10,17-18,34H,11-16,19H2,1-3H3,(H,28,33);2H,1H2 |
| InChIKey | VOJGJZPQGDHEKB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|