C18H18ClF3N4O3S — CID 172831589
2-chloro-N,N-dimethyl-4-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3,4-thiadiazol-2-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 172831589) has the molecular formula C18H18ClF3N4O3S and a molecular weight of 462.88 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3,4-thiadiazol-2-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-N,N-dimethyl-4-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3,4-thiadiazol-2-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172831589 |
| Molecular Formula | C18H18ClF3N4O3S |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3,4-thiadiazol-2-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)c1ccc(-c2nnc(C3=CCNCC3)s2)cc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H17ClN4OS.C2HF3O2/c1-21(2)16(22)12-4-3-11(9-13(12)17)15-20-19-14(23-15)10-5-7-18-8-6-10;3-2(4,5)1(6)7/h3-5,9,18H,6-8H2,1-2H3;(H,6,7) |
| InChIKey | VOUWDRAAEBGTEL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |