About 1,2-benzothiazepine;methanesulfonic acid
1,2-benzothiazepine;methanesulfonic acid (PubChem CID 172832223) has the molecular formula C10H11NO3S2
and a molecular weight of 257.34 g/mol. Its IUPAC name is 1,2-benzothiazepine;methanesulfonic acid.
Molecular Properties
| Compound Name | 1,2-benzothiazepine;methanesulfonic acid |
| PubChem CID | 172832223 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 1,2-benzothiazepine;methanesulfonic acid |
| SMILES | C1=Cc2ccccc2SN=C1.CS(=O)(=O)O |
| InChI | InChI=1S/C9H7NS.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-11-9;1-5(2,3)4/h1-7H;1H3,(H,2,3,4) |
| InChIKey | VQXOTZOFLKTRKO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-benzothiazepine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzothiazepine;methanesulfonic acid?
The IUPAC name of 1,2-benzothiazepine;methanesulfonic acid (CID 172832223) is 1,2-benzothiazepine;methanesulfonic acid.
What is the SMILES notation for 1,2-benzothiazepine;methanesulfonic acid?
The canonical SMILES for 1,2-benzothiazepine;methanesulfonic acid is C1=Cc2ccccc2SN=C1.CS(=O)(=O)O.
What is the InChIKey of 1,2-benzothiazepine;methanesulfonic acid?
The InChIKey is VQXOTZOFLKTRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-11-9;1-5(2,3)4/h1-7H;1H3,(H,2,3,4).
What are the key properties of 1,2-benzothiazepine;methanesulfonic acid?
1,2-benzothiazepine;methanesulfonic acid has a molecular weight of 257.34 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzothiazepine;methanesulfonic acid is sourced from PubChem (CID 172832223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).