C11H18N4O4 — CID 172832606
1-methyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 172832606) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-methyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | 1-methyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 172832606 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-methyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | CN1CC(=O)NCC(=O)NCCNC(=O)CCC1=O |
| InChI | InChI=1S/C11H18N4O4/c1-15-7-10(18)14-6-9(17)13-5-4-12-8(16)2-3-11(15)19/h2-7H2,1H3,(H,12,16)(H,13,17)(H,14,18) |
| InChIKey | VSEXOHMTHIARFK-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |