About 4-N-ethoxybenzene-1,4-diamine;sulfuric acid
4-N-ethoxybenzene-1,4-diamine;sulfuric acid (PubChem CID 172834421) has the molecular formula C8H14N2O5S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-N-ethoxybenzene-1,4-diamine;sulfuric acid.
Molecular Properties
| Compound Name | 4-N-ethoxybenzene-1,4-diamine;sulfuric acid |
| PubChem CID | 172834421 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-N-ethoxybenzene-1,4-diamine;sulfuric acid |
| SMILES | CCONc1ccc(N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N2O.H2O4S/c1-2-11-10-8-5-3-7(9)4-6-8;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4) |
| InChIKey | VYOCUUHEYNUVQD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-N-ethoxybenzene-1,4-diamine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-ethoxybenzene-1,4-diamine;sulfuric acid?
The IUPAC name of 4-N-ethoxybenzene-1,4-diamine;sulfuric acid (CID 172834421) is 4-N-ethoxybenzene-1,4-diamine;sulfuric acid.
What is the SMILES notation for 4-N-ethoxybenzene-1,4-diamine;sulfuric acid?
The canonical SMILES for 4-N-ethoxybenzene-1,4-diamine;sulfuric acid is CCONc1ccc(N)cc1.O=S(=O)(O)O.
What is the InChIKey of 4-N-ethoxybenzene-1,4-diamine;sulfuric acid?
The InChIKey is VYOCUUHEYNUVQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.H2O4S/c1-2-11-10-8-5-3-7(9)4-6-8;1-5(2,3)4/h3-6,10H,2,9H2,1H3;(H2,1,2,3,4).
What are the key properties of 4-N-ethoxybenzene-1,4-diamine;sulfuric acid?
4-N-ethoxybenzene-1,4-diamine;sulfuric acid has a molecular weight of 250.28 g/mol, XLogP of 0.98, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-ethoxybenzene-1,4-diamine;sulfuric acid is sourced from PubChem (CID 172834421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).