C30H53FO6Si2 — CID 172834433
[(2R,3S,4R,5R,6R)-2-fluoro-4-phenylmethoxy-5-triethylsilyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate (PubChem CID 172834433) has the molecular formula C30H53FO6Si2 and a molecular weight of 584.92 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2-fluoro-4-phenylmethoxy-5-triethylsilyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2-fluoro-4-phenylmethoxy-5-triethylsilyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 172834433 |
| Molecular Formula | C30H53FO6Si2 |
| Molecular Weight | 584.92 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2-fluoro-4-phenylmethoxy-5-triethylsilyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](OCc2ccccc2)[C@H](OC(C)=O)[C@@H](F)O[C@@H]1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H53FO6Si2/c1-11-38(12-2,13-3)37-27-26(20-34-39(21(4)5,22(6)7)23(8)9)36-30(31)29(35-24(10)32)28(27)33-19-25-17-15-14-16-18-25/h14-18,21-23,26-30H,11-13,19-20H2,1-10H3/t26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | VYPJRWAYGPHVSY-ZNOUKXQUSA-N |
| XLogP | 7.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.92 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|