About 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine
2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine (PubChem CID 172834890) has the molecular formula C12H23N3O5S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine.
Molecular Properties
| Compound Name | 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine |
| PubChem CID | 172834890 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine |
| SMILES | CCCCCCC(SCC1NC(=O)NC1=O)C(=O)O.NO |
| InChI | InChI=1S/C12H20N2O4S.H3NO/c1-2-3-4-5-6-9(11(16)17)19-7-8-10(15)14-12(18)13-8;1-2/h8-9H,2-7H2,1H3,(H,16,17)(H2,13,14,15,18);2H,1H2 |
| InChIKey | WACBIOXBHWPILI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine?
The IUPAC name of 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine (CID 172834890) is 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine.
What is the SMILES notation for 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine?
The canonical SMILES for 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine is CCCCCCC(SCC1NC(=O)NC1=O)C(=O)O.NO.
What is the InChIKey of 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine?
The InChIKey is WACBIOXBHWPILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4S.H3NO/c1-2-3-4-5-6-9(11(16)17)19-7-8-10(15)14-12(18)13-8;1-2/h8-9H,2-7H2,1H3,(H,16,17)(H2,13,14,15,18);2H,1H2.
What are the key properties of 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine?
2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine has a molecular weight of 321.40 g/mol, XLogP of 0.69, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]octanoic acid;hydroxylamine is sourced from PubChem (CID 172834890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).