About N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine
N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine (PubChem CID 172837037) has the molecular formula C15H18BrN5O
and a molecular weight of 364.25 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine.
Molecular Properties
| Compound Name | N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine |
| PubChem CID | 172837037 |
| Molecular Formula | C15H18BrN5O |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine |
| SMILES | CC(C)=CC(=O)Nc1cccc(Br)n1.Nc1cccc(N)n1 |
| InChI | InChI=1S/C10H11BrN2O.C5H7N3/c1-7(2)6-10(14)13-9-5-3-4-8(11)12-9;6-4-2-1-3-5(7)8-4/h3-6H,1-2H3,(H,12,13,14);1-3H,(H4,6,7,8) |
| InChIKey | WHCLHHFNHDUZCN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine?
The IUPAC name of N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine (CID 172837037) is N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine.
What is the SMILES notation for N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine?
The canonical SMILES for N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine is CC(C)=CC(=O)Nc1cccc(Br)n1.Nc1cccc(N)n1.
What is the InChIKey of N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine?
The InChIKey is WHCLHHFNHDUZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O.C5H7N3/c1-7(2)6-10(14)13-9-5-3-4-8(11)12-9;6-4-2-1-3-5(7)8-4/h3-6H,1-2H3,(H,12,13,14);1-3H,(H4,6,7,8).
What are the key properties of N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine?
N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine has a molecular weight of 364.25 g/mol, XLogP of 2.99, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2-pyridinyl)-3-methylbut-2-enamide;pyridine-2,6-diamine is sourced from PubChem (CID 172837037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).