C38H45ClF3N2O4SSi+ — CID 172837113
2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylsulfanyl]-3,5,6-trifluorobenzoic acid (PubChem CID 172837113) has the molecular formula C38H45ClF3N2O4SSi+ and a molecular weight of 746.39 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylsulfanyl]-3,5,6-trifluorobenzoic acid.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylsulfanyl]-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 172837113 |
| Molecular Formula | C38H45ClF3N2O4SSi+ |
| Molecular Weight | 746.39 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylsulfanyl]-3,5,6-trifluorobenzoic acid |
| SMILES | C[Si]1(C)C2=CC(=[N+]3CCC3)C=CC2=C(c2c(F)c(SCCOCCOCCCCCCCl)c(F)c(F)c2C(=O)O)c2ccc(N3CCC3)cc21 |
| InChI | InChI=1S/C38H44ClF3N2O4SSi/c1-50(2)29-23-25(43-14-7-15-43)9-11-27(29)31(28-12-10-26(24-30(28)50)44-16-8-17-44)32-33(38(45)46)34(40)36(42)37(35(32)41)49-22-21-48-20-19-47-18-6-4-3-5-13-39/h9-12,23-24H,3-8,13-22H2,1-2H3/p+1 |
| InChIKey | WHHYQOWWJPQXTJ-UHFFFAOYSA-O |
| XLogP | 7.56 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.39 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|