C12H24O5S — CID 172837260
[(2R,3S)-2,3,4-trihydroxy-6,6-dimethylheptyl] 2-sulfanylpropanoate (PubChem CID 172837260) has the molecular formula C12H24O5S and a molecular weight of 280.39 g/mol. Its IUPAC name is [(2R,3S)-2,3,4-trihydroxy-6,6-dimethylheptyl] 2-sulfanylpropanoate.
| Compound Name | [(2R,3S)-2,3,4-trihydroxy-6,6-dimethylheptyl] 2-sulfanylpropanoate |
|---|---|
| PubChem CID | 172837260 |
| Molecular Formula | C12H24O5S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(2R,3S)-2,3,4-trihydroxy-6,6-dimethylheptyl] 2-sulfanylpropanoate |
| SMILES | CC(S)C(=O)OC[C@@H](O)[C@@H](O)C(O)CC(C)(C)C |
| InChI | InChI=1S/C12H24O5S/c1-7(18)11(16)17-6-9(14)10(15)8(13)5-12(2,3)4/h7-10,13-15,18H,5-6H2,1-4H3/t7?,8?,9-,10+/m1/s1 |
| InChIKey | WHWXKNNDCTWLCB-BMNUFHGDSA-N |
| XLogP | 0.37 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|