C33H52O3P+ — CID 172837734
1,9-ditert-butyl-11-hydroxy-3,5,7-trimethyl-11-nonyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium (PubChem CID 172837734) has the molecular formula C33H52O3P+ and a molecular weight of 527.75 g/mol. Its IUPAC name is 1,9-ditert-butyl-11-hydroxy-3,5,7-trimethyl-11-nonyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium.
| Compound Name | 1,9-ditert-butyl-11-hydroxy-3,5,7-trimethyl-11-nonyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium |
|---|---|
| PubChem CID | 172837734 |
| Molecular Formula | C33H52O3P+ |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | 1,9-ditert-butyl-11-hydroxy-3,5,7-trimethyl-11-nonyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium |
| SMILES | CCCCCCCCC[P+]1(O)Oc2c(cc(C)cc2C(C)(C)C)C(C)c2cc(C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C33H52O3P/c1-11-12-13-14-15-16-17-18-37(34)35-30-26(19-23(2)21-28(30)32(5,6)7)25(4)27-20-24(3)22-29(31(27)36-37)33(8,9)10/h19-22,25,34H,11-18H2,1-10H3/q+1 |
| InChIKey | XNXKTONTVCWYBI-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|