C12H26N4O6S2 — CID 172837969
N-[2-[(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide;sulfuric acid (PubChem CID 172837969) has the molecular formula C12H26N4O6S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[2-[(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide;sulfuric acid.
| Compound Name | N-[2-[(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide;sulfuric acid |
|---|---|
| PubChem CID | 172837969 |
| Molecular Formula | C12H26N4O6S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[2-[(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide;sulfuric acid |
| SMILES | CCN(CCNS(C)(=O)=O)C1=CC(C)C(N)(N)C=C1.O=S(=O)(O)O |
| InChI | InChI=1S/C12H24N4O2S.H2O4S/c1-4-16(8-7-15-19(3,17)18)11-5-6-12(13,14)10(2)9-11;1-5(2,3)4/h5-6,9-10,15H,4,7-8,13-14H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | WKJMDPCJFADNLO-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 176.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|