C6H9N5O4 — CID 172839351
3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)propanehydrazide (PubChem CID 172839351) has the molecular formula C6H9N5O4 and a molecular weight of 215.17 g/mol. Its IUPAC name is 3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)propanehydrazide.
| Compound Name | 3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 172839351 |
| Molecular Formula | C6H9N5O4 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N5O4/c7-10-3(12)1-2-11-5(14)8-4(13)9-6(11)15/h1-2,7H2,(H,10,12)(H2,8,9,13,14,15) |
| InChIKey | WOWVFULFOVCZIC-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|