C35H49N6O7+ — CID 172839738
2-(5-carboxyfuran-2-yl)-6-[[5-methyl-3-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-pyrazol-4-yl]diazenyl]phenolate;bis(2-hydroxyethyl(trimethyl)azanium) (PubChem CID 172839738) has the molecular formula C35H49N6O7+ and a molecular weight of 665.81 g/mol. Its IUPAC name is 2-(5-carboxyfuran-2-yl)-6-[[5-methyl-3-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-pyrazol-4-yl]diazenyl]phenolate;bis(2-hydroxyethyl(trimethyl)azanium).
| Compound Name | 2-(5-carboxyfuran-2-yl)-6-[[5-methyl-3-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-pyrazol-4-yl]diazenyl]phenolate;bis(2-hydroxyethyl(trimethyl)azanium) |
|---|---|
| PubChem CID | 172839738 |
| Molecular Formula | C35H49N6O7+ |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.37 |
| IUPAC Name | 2-(5-carboxyfuran-2-yl)-6-[[5-methyl-3-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-pyrazol-4-yl]diazenyl]phenolate;bis(2-hydroxyethyl(trimethyl)azanium) |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.Cc1[nH]n(-c2ccc3c(c2)CCCC3)c(=O)c1/N=N/c1cccc(-c2ccc(C(=O)O)o2)c1[O-] |
| InChI | InChI=1S/C25H22N4O5.2C5H14NO/c1-14-22(24(31)29(28-14)17-10-9-15-5-2-3-6-16(15)13-17)27-26-19-8-4-7-18(23(19)30)20-11-12-21(34-20)25(32)33;2*1-6(2,3)4-5-7/h4,7-13,28,30H,2-3,5-6H2,1H3,(H,32,33);2*7H,4-5H2,1-3H3/q;2*+1/p-1/b27-26+;; |
| InChIKey | GVMKILSQWUNNPF-YOYNBWDYSA-M |
| XLogP | 4.17 |
| TPSA | 176.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|