About potassium;3-aminopropane-1-sulfonic acid;chloride
potassium;3-aminopropane-1-sulfonic acid;chloride (PubChem CID 172840895) has the molecular formula C3H9ClKNO3S
and a molecular weight of 213.73 g/mol. Its IUPAC name is potassium;3-aminopropane-1-sulfonic acid;chloride.
Molecular Properties
| Compound Name | potassium;3-aminopropane-1-sulfonic acid;chloride |
| PubChem CID | 172840895 |
| Molecular Formula | C3H9ClKNO3S |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 212.96 |
| IUPAC Name | potassium;3-aminopropane-1-sulfonic acid;chloride |
| SMILES | NCCCS(=O)(=O)O.[Cl-].[K+] |
| InChI | InChI=1S/C3H9NO3S.ClH.K/c4-2-1-3-8(5,6)7;;/h1-4H2,(H,5,6,7);1H;/q;;+1/p-1 |
| InChIKey | WTXBYCMUOMNPNO-UHFFFAOYSA-M |
| XLogP | -6.77 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | -6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-aminopropane-1-sulfonic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-aminopropane-1-sulfonic acid;chloride?
The IUPAC name of potassium;3-aminopropane-1-sulfonic acid;chloride (CID 172840895) is potassium;3-aminopropane-1-sulfonic acid;chloride.
What is the SMILES notation for potassium;3-aminopropane-1-sulfonic acid;chloride?
The canonical SMILES for potassium;3-aminopropane-1-sulfonic acid;chloride is NCCCS(=O)(=O)O.[Cl-].[K+].
What is the InChIKey of potassium;3-aminopropane-1-sulfonic acid;chloride?
The InChIKey is WTXBYCMUOMNPNO-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9NO3S.ClH.K/c4-2-1-3-8(5,6)7;;/h1-4H2,(H,5,6,7);1H;/q;;+1/p-1.
What are the key properties of potassium;3-aminopropane-1-sulfonic acid;chloride?
potassium;3-aminopropane-1-sulfonic acid;chloride has a molecular weight of 213.73 g/mol, XLogP of -6.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-aminopropane-1-sulfonic acid;chloride is sourced from PubChem (CID 172840895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).