C7H11N5O4 — CID 172841309
4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanehydrazide (PubChem CID 172841309) has the molecular formula C7H11N5O4 and a molecular weight of 229.20 g/mol. Its IUPAC name is 4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanehydrazide.
| Compound Name | 4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 172841309 |
| Molecular Formula | C7H11N5O4 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)butanehydrazide |
| SMILES | NNC(=O)CCCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H11N5O4/c8-11-4(13)2-1-3-12-6(15)9-5(14)10-7(12)16/h1-3,8H2,(H,11,13)(H2,9,10,14,15,16) |
| InChIKey | WVGDAFOBHZUMEO-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|