About CID 172841452
CID 172841452 (PubChem CID 172841452) has the molecular formula C45H38F6Zr
and a molecular weight of 784.01 g/mol.
Molecular Properties
| Compound Name | CID 172841452 |
| PubChem CID | 172841452 |
| Molecular Formula | C45H38F6Zr |
| Molecular Weight | 784.01 g/mol |
| Exact Mass | 782.19 |
| IUPAC Name | — |
| SMILES | CC1(C)[C-]=Cc2cc3c(cc21)Cc1cc2c(cc1-3)C=CC2(C)C.Cc1c[cH-]c(C)c1.FC(F)(F)c1ccc(C(=[Zr+2])c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H21.C15H8F6.C7H9.Zr/c1-22(2)7-5-14-10-18-16(12-20(14)22)9-17-13-21-15(11-19(17)18)6-8-23(21,3)4;16-14(17,18)12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)15(19,20)21;1-6-3-4-7(2)5-6;/h5-7,10-13H,9H2,1-4H3;1-8H;3-5H,1-2H3;/q-1;;-1;+2 |
| InChIKey | HJFISDFJWBEWKP-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 784.01 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 172841452 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172841452?
The IUPAC name of CID 172841452 (CID 172841452) is not available.
What is the SMILES notation for CID 172841452?
The canonical SMILES for CID 172841452 is CC1(C)[C-]=Cc2cc3c(cc21)Cc1cc2c(cc1-3)C=CC2(C)C.Cc1c[cH-]c(C)c1.FC(F)(F)c1ccc(C(=[Zr+2])c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of CID 172841452?
The InChIKey is HJFISDFJWBEWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21.C15H8F6.C7H9.Zr/c1-22(2)7-5-14-10-18-16(12-20(14)22)9-17-13-21-15(11-19(17)18)6-8-23(21,3)4;16-14(17,18)12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)15(19,20)21;1-6-3-4-7(2)5-6;/h5-7,10-13H,9H2,1-4H3;1-8H;3-5H,1-2H3;/q-1;;-1;+2.
What are the key properties of CID 172841452?
CID 172841452 has a molecular weight of 784.01 g/mol, XLogP of 12.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172841452 is sourced from PubChem (CID 172841452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).