C35H47O4P — CID 172841477
1,3,7,9-tetratert-butyl-11-phenoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 172841477) has the molecular formula C35H47O4P and a molecular weight of 562.73 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-11-phenoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 1,3,7,9-tetratert-butyl-11-phenoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 172841477 |
| Molecular Formula | C35H47O4P |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-11-phenoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(=O)(Oc1ccccc1)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C35H47O4P/c1-32(2,3)25-19-23-18-24-20-26(33(4,5)6)22-29(35(10,11)12)31(24)39-40(36,37-27-16-14-13-15-17-27)38-30(23)28(21-25)34(7,8)9/h13-17,19-22H,18H2,1-12H3 |
| InChIKey | WVTBMTNMHJSEFD-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|