About tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate
tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 172841936) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 172841936 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | [H]/N=C1\NC(=O)NC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C12H20N4O3/c1-11(2,3)19-10(18)16-6-4-12(5-7-16)8(13)14-9(17)15-12/h4-7H2,1-3H3,(H3,13,14,15,17) |
| InChIKey | WXEQJVHNMDCDKT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The IUPAC name of tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CID 172841936) is tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate is [H]/N=C1\NC(=O)NC12CCN(C(=O)OC(C)(C)C)CC2.
What is the InChIKey of tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
The InChIKey is WXEQJVHNMDCDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-11(2,3)19-10(18)16-6-4-12(5-7-16)8(13)14-9(17)15-12/h4-7H2,1-3H3,(H3,13,14,15,17).
What are the key properties of tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate?
tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate has a molecular weight of 268.32 g/mol, XLogP of 1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-imino-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 172841936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).