About (5-formylfuran-2-yl) 2-methylbenzenesulfonate
(5-formylfuran-2-yl) 2-methylbenzenesulfonate (PubChem CID 172842195) has the molecular formula C12H10O5S
and a molecular weight of 266.27 g/mol. Its IUPAC name is (5-formylfuran-2-yl) 2-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (5-formylfuran-2-yl) 2-methylbenzenesulfonate |
| PubChem CID | 172842195 |
| Molecular Formula | C12H10O5S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (5-formylfuran-2-yl) 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)Oc1ccc(C=O)o1 |
| InChI | InChI=1S/C12H10O5S/c1-9-4-2-3-5-11(9)18(14,15)17-12-7-6-10(8-13)16-12/h2-8H,1H3 |
| InChIKey | WYBPMDDQSOFHFD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-formylfuran-2-yl) 2-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formylfuran-2-yl) 2-methylbenzenesulfonate?
The IUPAC name of (5-formylfuran-2-yl) 2-methylbenzenesulfonate (CID 172842195) is (5-formylfuran-2-yl) 2-methylbenzenesulfonate.
What is the SMILES notation for (5-formylfuran-2-yl) 2-methylbenzenesulfonate?
The canonical SMILES for (5-formylfuran-2-yl) 2-methylbenzenesulfonate is Cc1ccccc1S(=O)(=O)Oc1ccc(C=O)o1.
What is the InChIKey of (5-formylfuran-2-yl) 2-methylbenzenesulfonate?
The InChIKey is WYBPMDDQSOFHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O5S/c1-9-4-2-3-5-11(9)18(14,15)17-12-7-6-10(8-13)16-12/h2-8H,1H3.
What are the key properties of (5-formylfuran-2-yl) 2-methylbenzenesulfonate?
(5-formylfuran-2-yl) 2-methylbenzenesulfonate has a molecular weight of 266.27 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formylfuran-2-yl) 2-methylbenzenesulfonate is sourced from PubChem (CID 172842195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).