About ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride
ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride (PubChem CID 172842550) has the molecular formula C13H30ClP
and a molecular weight of 252.81 g/mol. Its IUPAC name is ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride.
Molecular Properties
| Compound Name | ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride |
| PubChem CID | 172842550 |
| Molecular Formula | C13H30ClP |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride |
| SMILES | CC(C)(C)CP(C(C)(C)C)C(C)(C)C.Cl |
| InChI | InChI=1S/C13H29P.ClH/c1-11(2,3)10-14(12(4,5)6)13(7,8)9;/h10H2,1-9H3;1H |
| InChIKey | WZHVMTCTBGIBGJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride?
The IUPAC name of ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride (CID 172842550) is ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride.
What is the SMILES notation for ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride?
The canonical SMILES for ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride is CC(C)(C)CP(C(C)(C)C)C(C)(C)C.Cl.
What is the InChIKey of ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride?
The InChIKey is WZHVMTCTBGIBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29P.ClH/c1-11(2,3)10-14(12(4,5)6)13(7,8)9;/h10H2,1-9H3;1H.
What are the key properties of ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride?
ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride has a molecular weight of 252.81 g/mol, XLogP of 5.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(2,2-dimethylpropyl)phosphane;hydrochloride is sourced from PubChem (CID 172842550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).