C8H8N6O3 — CID 172843621
2-ethenyl-1,3,5-triazine;1,3,5-triazinane-2,4,6-trione (PubChem CID 172843621) has the molecular formula C8H8N6O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is 2-ethenyl-1,3,5-triazine;1,3,5-triazinane-2,4,6-trione.
| Compound Name | 2-ethenyl-1,3,5-triazine;1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172843621 |
| Molecular Formula | C8H8N6O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-ethenyl-1,3,5-triazine;1,3,5-triazinane-2,4,6-trione |
| SMILES | C=Cc1ncncn1.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N3.C3H3N3O3/c1-2-5-7-3-6-4-8-5;7-1-4-2(8)6-3(9)5-1/h2-4H,1H2;(H3,4,5,6,7,8,9) |
| InChIKey | XCXGTTUXAAWEGU-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |