About N-acetylacetamide;hafnium
N-acetylacetamide;hafnium (PubChem CID 172844239) has the molecular formula C4H7HfNO2
and a molecular weight of 279.60 g/mol. Its IUPAC name is N-acetylacetamide;hafnium.
Molecular Properties
| Compound Name | N-acetylacetamide;hafnium |
| PubChem CID | 172844239 |
| Molecular Formula | C4H7HfNO2 |
| Molecular Weight | 279.60 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | N-acetylacetamide;hafnium |
| SMILES | CC(=O)NC(C)=O.[Hf] |
| InChI | InChI=1S/C4H7NO2.Hf/c1-3(6)5-4(2)7;/h1-2H3,(H,5,6,7); |
| InChIKey | XEXYECMFMDTHAR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.60 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-acetylacetamide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylacetamide;hafnium?
The IUPAC name of N-acetylacetamide;hafnium (CID 172844239) is N-acetylacetamide;hafnium.
What is the SMILES notation for N-acetylacetamide;hafnium?
The canonical SMILES for N-acetylacetamide;hafnium is CC(=O)NC(C)=O.[Hf].
What is the InChIKey of N-acetylacetamide;hafnium?
The InChIKey is XEXYECMFMDTHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.Hf/c1-3(6)5-4(2)7;/h1-2H3,(H,5,6,7);.
What are the key properties of N-acetylacetamide;hafnium?
N-acetylacetamide;hafnium has a molecular weight of 279.60 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylacetamide;hafnium is sourced from PubChem (CID 172844239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).